Products 1072945-94-8

CAS 1072945-94-8 is the registry number for 3-(2-Nitro-4-trifluoromethylphenoxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]boronic acid (CAS 1072945-94-8) is a chemical compound with the molecular formula C13H9BF3NO5 and a molecular weight of 327.02 g/mol. IUPAC name: [3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]boronic acid. InChIKey: UYSSHRQLWIRFRP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BF3NO5
Molecular weight327.02 g/mol
IUPAC name[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]boronic acid
InChIKeyUYSSHRQLWIRFRP-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)OC2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-])(O)O

Computed by PubChem (NCBI)