Products 1072945-96-0

CAS 1072945-96-0 is the registry number for 3-(4-Fluoro-2-nitrophenoxy)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-(4-fluoro-2-nitrophenoxy)phenyl]boronic acid (CAS 1072945-96-0) is a chemical compound with the molecular formula C12H9BFNO5 and a molecular weight of 277.01 g/mol. IUPAC name: [3-(4-fluoro-2-nitrophenoxy)phenyl]boronic acid. InChIKey: PFNVDOGFMYGBQN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9BFNO5
Molecular weight277.01 g/mol
IUPAC name[3-(4-fluoro-2-nitrophenoxy)phenyl]boronic acid
InChIKeyPFNVDOGFMYGBQN-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)OC2=C(C=C(C=C2)F)[N+](=O)[O-])(O)O

Computed by PubChem (NCBI)