CAS 1072946-04-3 appears in our catalog under these names: N-(3-Chloro-4-fluorophenyl) 3-boronobenzamide, 98%, (3-((3-Chloro-4-fluorophenyl)carbamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g, 250mg.
[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]boronic acid (CAS 1072946-04-3) is a chemical compound with the molecular formula C13H10BClFNO3 and a molecular weight of 293.49 g/mol. IUPAC name: [3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: RSMFAQCLGXKQAT-UHFFFAOYSA-N.
| Molecular formula | C13H10BClFNO3 |
|---|---|
| Molecular weight | 293.49 g/mol |
| IUPAC name | [3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | RSMFAQCLGXKQAT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC(=C(C=C2)F)Cl)(O)O |
Computed by PubChem (NCBI)