Products 1072946-15-6

CAS 1072946-15-6 is the registry number for N-(3,4-Difluorophenyl) 3-boronobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[3-[(3,4-difluorophenyl)carbamoyl]phenyl]boronic acid (CAS 1072946-15-6) is a chemical compound with the molecular formula C13H10BF2NO3 and a molecular weight of 277.03 g/mol. IUPAC name: [3-[(3,4-difluorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: BNTBFLHBIBBLLS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10BF2NO3
Molecular weight277.03 g/mol
IUPAC name[3-[(3,4-difluorophenyl)carbamoyl]phenyl]boronic acid
InChIKeyBNTBFLHBIBBLLS-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)NC2=CC(=C(C=C2)F)F)(O)O

Computed by PubChem (NCBI)