CAS 1072946-16-7 appears in our catalog under these names: 4-(Methylsulfonyl)-2-(trifluoromethyl)phenylboronic acid, 98%, (4-(Methylsulfonyl)-2-(trifluoromethyl)phenyl)boronic acid, 98%, 4-(Methylsulfonyl)-2-(trifluoromethyl)phenylboronic acid, ≥95%, ≥95%, (4-(Methylsulfonyl)-2-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 10g.
[4-methylsulfonyl-2-(trifluoromethyl)phenyl]boronic acid (CAS 1072946-16-7) is a chemical compound with the molecular formula C8H8BF3O4S and a molecular weight of 268.02 g/mol. IUPAC name: [4-methylsulfonyl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: KRVRNINHXGLIEL-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O4S |
|---|---|
| Molecular weight | 268.02 g/mol |
| IUPAC name | [4-methylsulfonyl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | KRVRNINHXGLIEL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)