CAS 1072946-17-8 is the registry number for 3-(3-Methylthioureido)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-(methylcarbamothioylamino)phenyl]boronic acid (CAS 1072946-17-8) is a chemical compound with the molecular formula C8H11BN2O2S and a molecular weight of 210.07 g/mol. IUPAC name: [3-(methylcarbamothioylamino)phenyl]boronic acid. InChIKey: BRXUVOXFWKMDPA-UHFFFAOYSA-N.
| Molecular formula | C8H11BN2O2S |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | [3-(methylcarbamothioylamino)phenyl]boronic acid |
| InChIKey | BRXUVOXFWKMDPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=S)NC)(O)O |
Computed by PubChem (NCBI)