CAS 1072946-23-6 is the registry number for Bis(3,4-dimethylphenyl)borinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Bis(3,4-dimethylphenyl)borinic acid (CAS 1072946-23-6) is a chemical compound with the molecular formula C16H19BO and a molecular weight of 238.1 g/mol. IUPAC name: bis(3,4-dimethylphenyl)borinic acid. InChIKey: RLUUJGCHAAXMFW-UHFFFAOYSA-N.
| Molecular formula | C16H19BO |
|---|---|
| Molecular weight | 238.1 g/mol |
| IUPAC name | bis(3,4-dimethylphenyl)borinic acid |
| InChIKey | RLUUJGCHAAXMFW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C)(C2=CC(=C(C=C2)C)C)O |
Computed by PubChem (NCBI)