Products 1072946-23-6

CAS 1072946-23-6 is the registry number for Bis(3,4-dimethylphenyl)borinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Bis(3,4-dimethylphenyl)borinic acid (CAS 1072946-23-6) is a chemical compound with the molecular formula C16H19BO and a molecular weight of 238.1 g/mol. IUPAC name: bis(3,4-dimethylphenyl)borinic acid. InChIKey: RLUUJGCHAAXMFW-UHFFFAOYSA-N.

Identity
Molecular formulaC16H19BO
Molecular weight238.1 g/mol
IUPAC namebis(3,4-dimethylphenyl)borinic acid
InChIKeyRLUUJGCHAAXMFW-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)C)C)(C2=CC(=C(C=C2)C)C)O

Computed by PubChem (NCBI)