CAS 1072946-29-2 is the registry number for 4-(1-BOC-piperidin-4-yloxy)-2-methoxyphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
[2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]boronic acid (CAS 1072946-29-2) is a chemical compound with the molecular formula C17H26BNO6 and a molecular weight of 351.2 g/mol. IUPAC name: [2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]boronic acid. InChIKey: IKZNJZJEWBIUGX-UHFFFAOYSA-N.
| Molecular formula | C17H26BNO6 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | [2-methoxy-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxyphenyl]boronic acid |
| InChIKey | IKZNJZJEWBIUGX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC2CCN(CC2)C(=O)OC(C)(C)C)OC)(O)O |
Computed by PubChem (NCBI)