CAS 1072946-34-9 appears in our catalog under these names: 3,4,5-Trichloro-2-methylphenylboronic acid, 96%, (3,4,5-Trichloro-2-methylphenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
(3,4,5-trichloro-2-methylphenyl)boronic acid (CAS 1072946-34-9) is a chemical compound with the molecular formula C7H6BCl3O2 and a molecular weight of 239.3 g/mol. IUPAC name: (3,4,5-trichloro-2-methylphenyl)boronic acid. InChIKey: NEKATBSATBTEKT-UHFFFAOYSA-N.
| Molecular formula | C7H6BCl3O2 |
|---|---|
| Molecular weight | 239.3 g/mol |
| IUPAC name | (3,4,5-trichloro-2-methylphenyl)boronic acid |
| InChIKey | NEKATBSATBTEKT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1C)Cl)Cl)Cl)(O)O |
Computed by PubChem (NCBI)