CAS 1072946-38-3 is the registry number for 2,3,4-Trichloro-5-nitrophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2,3,4-trichloro-5-nitrophenyl)boronic acid (CAS 1072946-38-3) is a chemical compound with the molecular formula C6H3BCl3NO4 and a molecular weight of 270.3 g/mol. IUPAC name: (2,3,4-trichloro-5-nitrophenyl)boronic acid. InChIKey: ZUBMJZYQEWYAHH-UHFFFAOYSA-N.
| Molecular formula | C6H3BCl3NO4 |
|---|---|
| Molecular weight | 270.3 g/mol |
| IUPAC name | (2,3,4-trichloro-5-nitrophenyl)boronic acid |
| InChIKey | ZUBMJZYQEWYAHH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1Cl)Cl)Cl)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)