CAS 1072946-51-0 is the registry number for 3-(1,3-Dioxolan-2-yl)-5-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-(1,3-dioxolan-2-yl)-5-(trifluoromethyl)phenyl]boronic acid (CAS 1072946-51-0) is a chemical compound with the molecular formula C10H10BF3O4 and a molecular weight of 261.99 g/mol. IUPAC name: [3-(1,3-dioxolan-2-yl)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: QPNGCFKECJVVNJ-UHFFFAOYSA-N.
| Molecular formula | C10H10BF3O4 |
|---|---|
| Molecular weight | 261.99 g/mol |
| IUPAC name | [3-(1,3-dioxolan-2-yl)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | QPNGCFKECJVVNJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(F)(F)F)C2OCCO2)(O)O |
Computed by PubChem (NCBI)