Products 1072946-61-2

CAS 1072946-61-2 is the registry number for 3-(4-Carboxybutoxy)-2,4,6-trifluorophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(3-borono-2,4,6-trifluorophenoxy)pentanoic acid (CAS 1072946-61-2) is a chemical compound with the molecular formula C11H12BF3O5 and a molecular weight of 292.02 g/mol. IUPAC name: 5-(3-borono-2,4,6-trifluorophenoxy)pentanoic acid. InChIKey: VITMYQUXGWOXGS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12BF3O5
Molecular weight292.02 g/mol
IUPAC name5-(3-borono-2,4,6-trifluorophenoxy)pentanoic acid
InChIKeyVITMYQUXGWOXGS-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1F)F)OCCCCC(=O)O)F)(O)O

Computed by PubChem (NCBI)