CAS 1072946-65-6 is the registry number for 3-(tert-Butyldimethylsilyloxy)-2,4,6-trifluorophenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trifluorophenyl]boronic acid (CAS 1072946-65-6) is a chemical compound with the molecular formula C12H18BF3O3Si and a molecular weight of 306.16 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trifluorophenyl]boronic acid. InChIKey: UCXQKSZNRSUFMW-UHFFFAOYSA-N.
| Molecular formula | C12H18BF3O3Si |
|---|---|
| Molecular weight | 306.16 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trifluorophenyl]boronic acid |
| InChIKey | UCXQKSZNRSUFMW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1F)F)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)