CAS 1072951-57-5 appears in our catalog under these names: 5–BROMO–2–TRIFLUOROMETHYLPYRIDINE–4–BORONIC ACID, 5-Bromo-2-trifluoromethylpyridine-4-boronic acid, 96%, 5-Bromo-2-trifluoromethylpyridine-4-boronic acid 98%, 5-Bromo-2-trifluoromethylpyridine-4-boronic acid, 98%, 98%, 5-BROMO-2-TRIFLUOROMETHYLPYRIDINE-4-BORONIC ACID, 98%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
[5-bromo-2-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 1072951-57-5) is a chemical compound with the molecular formula C6H4BBrF3NO2 and a molecular weight of 269.81 g/mol. IUPAC name: [5-bromo-2-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: OBSKOYIEHGFTFF-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF3NO2 |
|---|---|
| Molecular weight | 269.81 g/mol |
| IUPAC name | [5-bromo-2-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | OBSKOYIEHGFTFF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1Br)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)