CAS 1072951-63-3 appears in our catalog under these names: 4-[(2',6'-Diisopropylphenoxy)methyl]phenylboronic acid, 95%, (4-((2,6-Diisopropylphenoxy)methyl)phenyl)boronic acid, ≥95%, ≥95%, (4-((2,6-Diisopropylphenoxy)methyl)phenyl)boronic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g.
[4-[[2,6-di(propan-2-yl)phenoxy]methyl]phenyl]boronic acid (CAS 1072951-63-3) is a chemical compound with the molecular formula C19H25BO3 and a molecular weight of 312.2 g/mol. IUPAC name: [4-[[2,6-di(propan-2-yl)phenoxy]methyl]phenyl]boronic acid. InChIKey: IYHHUWVULUSILI-UHFFFAOYSA-N.
| Molecular formula | C19H25BO3 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | [4-[[2,6-di(propan-2-yl)phenoxy]methyl]phenyl]boronic acid |
| InChIKey | IYHHUWVULUSILI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=C(C=CC=C2C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)