CAS 1072951-76-8 appears in our catalog under these names: 2-[(4'-tert-Butyl-2'-methylphenoxy)methyl]phenylboronic acid, 96%, (2-((4-(tert-Butyl)-2-methylphenoxy)methyl)phenyl)boronic acid 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg.
[2-[(4-tert-butyl-2-methylphenoxy)methyl]phenyl]boronic acid (CAS 1072951-76-8) is a chemical compound with the molecular formula C18H23BO3 and a molecular weight of 298.2 g/mol. IUPAC name: [2-[(4-tert-butyl-2-methylphenoxy)methyl]phenyl]boronic acid. InChIKey: DUXBNUDEXAKRNL-UHFFFAOYSA-N.
| Molecular formula | C18H23BO3 |
|---|---|
| Molecular weight | 298.2 g/mol |
| IUPAC name | [2-[(4-tert-butyl-2-methylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | DUXBNUDEXAKRNL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1COC2=C(C=C(C=C2)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)