CAS 1072951-86-0 appears in our catalog under these names: 3-Bromo-2-isopropoxy-5-formylphenylboronic acid, 97%, (3-Bromo-5-formyl-2-isopropoxyphenyl)boronic acid, 97%, (3-Bromo-5-formyl-2-isopropoxyphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(3-bromo-5-formyl-2-propan-2-yloxyphenyl)boronic acid (CAS 1072951-86-0) is a chemical compound with the molecular formula C10H12BBrO4 and a molecular weight of 286.92 g/mol. IUPAC name: (3-bromo-5-formyl-2-propan-2-yloxyphenyl)boronic acid. InChIKey: JDRHFOMNQQEZJZ-UHFFFAOYSA-N.
| Molecular formula | C10H12BBrO4 |
|---|---|
| Molecular weight | 286.92 g/mol |
| IUPAC name | (3-bromo-5-formyl-2-propan-2-yloxyphenyl)boronic acid |
| InChIKey | JDRHFOMNQQEZJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC(C)C)Br)C=O)(O)O |
Computed by PubChem (NCBI)