CAS 1072951-94-0 appears in our catalog under these names: 3,5-Dimethyl-4-(3',5'-dimethoxybenzyloxy)phenylboronic acid, 96%, (4-((3,5-Dimethoxybenzyl)oxy)-3,5-dimethylphenyl)boronic acid, 97%, 97%, (4-((3,5-Dimethoxybenzyl)oxy)-3,5-dimethylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
[4-[(3,5-dimethoxyphenyl)methoxy]-3,5-dimethylphenyl]boronic acid (CAS 1072951-94-0) is a chemical compound with the molecular formula C17H21BO5 and a molecular weight of 316.2 g/mol. IUPAC name: [4-[(3,5-dimethoxyphenyl)methoxy]-3,5-dimethylphenyl]boronic acid. InChIKey: VZHFHGUMGVBYBU-UHFFFAOYSA-N.
| Molecular formula | C17H21BO5 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | [4-[(3,5-dimethoxyphenyl)methoxy]-3,5-dimethylphenyl]boronic acid |
| InChIKey | VZHFHGUMGVBYBU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCC2=CC(=CC(=C2)OC)OC)C)(O)O |
Computed by PubChem (NCBI)