Products 1072952-12-5

CAS 1072952-12-5 appears in our catalog under these names: 2,4-Dichloro-5-nitrophenylboronic acid, 96%, (2,4-Dichloro-5-nitrophenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2,4-dichloro-5-nitrophenyl)boronic acid (CAS 1072952-12-5) is a chemical compound with the molecular formula C6H4BCl2NO4 and a molecular weight of 235.82 g/mol. IUPAC name: (2,4-dichloro-5-nitrophenyl)boronic acid. InChIKey: QZUUWAWNYJMANP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BCl2NO4
Molecular weight235.82 g/mol
IUPAC name(2,4-dichloro-5-nitrophenyl)boronic acid
InChIKeyQZUUWAWNYJMANP-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-])(O)O

Computed by PubChem (NCBI)