CAS 1072952-12-5 appears in our catalog under these names: 2,4-Dichloro-5-nitrophenylboronic acid, 96%, (2,4-Dichloro-5-nitrophenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
(2,4-dichloro-5-nitrophenyl)boronic acid (CAS 1072952-12-5) is a chemical compound with the molecular formula C6H4BCl2NO4 and a molecular weight of 235.82 g/mol. IUPAC name: (2,4-dichloro-5-nitrophenyl)boronic acid. InChIKey: QZUUWAWNYJMANP-UHFFFAOYSA-N.
| Molecular formula | C6H4BCl2NO4 |
|---|---|
| Molecular weight | 235.82 g/mol |
| IUPAC name | (2,4-dichloro-5-nitrophenyl)boronic acid |
| InChIKey | QZUUWAWNYJMANP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)