Products 1072952-30-7

CAS 1072952-30-7 is the registry number for 2-Picoline-5-boronic acid hydrate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(6-methyl-3-pyridinyl)boronic acid;hydrate (CAS 1072952-30-7) is a chemical compound with the molecular formula C6H10BNO3 and a molecular weight of 154.96 g/mol. IUPAC name: (6-methyl-3-pyridinyl)boronic acid;hydrate. InChIKey: JGZWRFLXUXUARM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10BNO3
Molecular weight154.96 g/mol
IUPAC name(6-methyl-3-pyridinyl)boronic acid;hydrate
InChIKeyJGZWRFLXUXUARM-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)C)(O)O.O

Computed by PubChem (NCBI)