CAS 1073135-81-5 appears in our catalog under these names: 5–Bromo–4–chloro–6–phenylfuro(2,3–d)pyrimidine, 5-Bromo-4-chloro-6-phenylfuro[2,3-d]pyrimidine, 98%, 98%, 5-Bromo-4-chloro-6-phenylfuro[2,3-d]pyrimidine, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-4-chloro-6-phenylfuro[2,3-d]pyrimidine (CAS 1073135-81-5) is a chemical compound with the molecular formula C12H6BrClN2O and a molecular weight of 309.54 g/mol. IUPAC name: 5-bromo-4-chloro-6-phenylfuro[2,3-d]pyrimidine. InChIKey: WWQPJSOHSIWQNE-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClN2O |
|---|---|
| Molecular weight | 309.54 g/mol |
| IUPAC name | 5-bromo-4-chloro-6-phenylfuro[2,3-d]pyrimidine |
| InChIKey | WWQPJSOHSIWQNE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C3=C(O2)N=CN=C3Cl)Br |
Computed by PubChem (NCBI)