CAS 1073263-81-6 is the registry number for rel-(3S,4R)-1-Benzyl-4-(4-fluorophenyl)-N-methylpyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-1-benzyl-4-(4-fluorophenyl)-N-methylpyrrolidin-3-amine (CAS 1073263-81-6) is a chemical compound with the molecular formula C18H21FN2 and a molecular weight of 284.4 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-(4-fluorophenyl)-N-methylpyrrolidin-3-amine. InChIKey: GGAMEJPJIDNAQA-ZWKOTPCHSA-N.
| Molecular formula | C18H21FN2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-(4-fluorophenyl)-N-methylpyrrolidin-3-amine |
| InChIKey | GGAMEJPJIDNAQA-ZWKOTPCHSA-N |
| SMILES | CN[C@@H]1CN(C[C@H]1C2=CC=C(C=C2)F)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)