CAS 1073339-08-8 is the registry number for 2-(3,4-Bis(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
2-[3,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073339-08-8) is a chemical compound with the molecular formula C14H15BF6O2 and a molecular weight of 340.07 g/mol. IUPAC name: 2-[3,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IFBHZHRQVSAGTE-UHFFFAOYSA-N.
| Molecular formula | C14H15BF6O2 |
|---|---|
| Molecular weight | 340.07 g/mol |
| IUPAC name | 2-[3,4-bis(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IFBHZHRQVSAGTE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)