CAS 1073354-30-9 is the registry number for 6-[Benzyl(methyl)amino]pyridine-3-boronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-benzyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1073354-30-9) is a chemical compound with the molecular formula C19H25BN2O2 and a molecular weight of 324.2 g/mol. IUPAC name: N-benzyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: BUXNUAOULVWKLP-UHFFFAOYSA-N.
| Molecular formula | C19H25BN2O2 |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | N-benzyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | BUXNUAOULVWKLP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N(C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)