CAS 1073354-49-0 is the registry number for 4-(4'-Allyloxycarbonylpiperizino)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Prop-2-enyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate (CAS 1073354-49-0) is a chemical compound with the molecular formula C20H29BN2O4 and a molecular weight of 372.3 g/mol. IUPAC name: prop-2-enyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate. InChIKey: CJPCQWNCEFXZGO-UHFFFAOYSA-N.
| Molecular formula | C20H29BN2O4 |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | prop-2-enyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine-1-carboxylate |
| InChIKey | CJPCQWNCEFXZGO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCN(CC3)C(=O)OCC=C |
Computed by PubChem (NCBI)