CAS 1073355-02-8 appears in our catalog under these names: 2-((tert-Butyldimethylsilanyl)ethynyl) boronic acid pinacol ester, 95%, 2-((TERT-BUTYLDIMETHYLSILANYL)ETHYNYL)&. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 5g, 1g.
Tert-butyl-dimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane (CAS 1073355-02-8) is a chemical compound with the molecular formula C14H27BO2Si and a molecular weight of 266.26 g/mol. IUPAC name: tert-butyl-dimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane. InChIKey: LBGATPGTEQCHFP-UHFFFAOYSA-N.
| Molecular formula | C14H27BO2Si |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | tert-butyl-dimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethynyl]silane |
| InChIKey | LBGATPGTEQCHFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C#C[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)