CAS 1073468-32-2 is the registry number for Potassium (3-cyanomethylphenyl)trifluoroborate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Potassium [3-(cyanomethyl)phenyl]-trifluoroboranuide (CAS 1073468-32-2) is a chemical compound with the molecular formula C8H6BF3KN and a molecular weight of 223.05 g/mol. IUPAC name: potassium [3-(cyanomethyl)phenyl]-trifluoroboranuide. InChIKey: ZKCMUCHAKQYUMT-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3KN |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | potassium [3-(cyanomethyl)phenyl]-trifluoroboranuide |
| InChIKey | ZKCMUCHAKQYUMT-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC=C1)CC#N)(F)(F)F.[K+] |
Computed by PubChem (NCBI)