Products 107368-27-4

CAS 107368-27-4 is the registry number for Ethyl 3-methyl-4-oxopent-2-enoate. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 3-methyl-4-oxopent-2-enoate (CAS 107368-27-4) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: ethyl 3-methyl-4-oxopent-2-enoate. InChIKey: RSZTVSCDAXYPTP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC nameethyl 3-methyl-4-oxopent-2-enoate
InChIKeyRSZTVSCDAXYPTP-UHFFFAOYSA-N
SMILESCCOC(=O)C=C(C)C(=O)C

Computed by PubChem (NCBI)