CAS 1073897-80-9 is the registry number for 1,3,5-Tricaffeoylquinic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 100mg, Get quote.
1,3,5-Tricaffeoylquinic acid is a tricaffeoylquinic acid derivative isolated from H. populifolium with anti-HIV effect.
Source: ChEBI
| Molecular formula | C34H30O15 |
|---|---|
| Molecular weight | 678.6 g/mol |
| IUPAC name | trans-(3R,5R)-1,3,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-4-hydroxycyclohexane-1-carboxylic acid |
| InChIKey | MSKVJEAKVWAQTA-JFPZSYFPSA-N |
| SMILES | C1C(C[C@H](C([C@@H]1OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)OC(=O)/C=C/C3=CC(=C(C=C3)O)O)(OC(=O)/C=C/C4=CC(=C(C=C4)O)O)C(=O)O |
Computed by PubChem (NCBI)