CAS 1074-29-9 is the registry number for Phenyltrichlorogermane, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Trichloro(phenyl)germane (CAS 1074-29-9) is a chemical compound with the molecular formula C6H5Cl3Ge and a molecular weight of 256.1 g/mol. IUPAC name: trichloro(phenyl)germane. InChIKey: CIWQSBMDFPABPQ-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3Ge |
|---|---|
| Molecular weight | 256.1 g/mol |
| IUPAC name | trichloro(phenyl)germane |
| InChIKey | CIWQSBMDFPABPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Ge](Cl)(Cl)Cl |
Computed by PubChem (NCBI)