CAS 107426-70-0 is the registry number for (p-Azidosalicylamido)ethyl-1,3′-dithiopropionic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid (CAS 107426-70-0) is a chemical compound with the molecular formula C12H14N4O4S2 and a molecular weight of 342.4 g/mol. IUPAC name: 3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid. InChIKey: AOMOESAZLQVHAJ-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O4S2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 3-[2-[(4-azido-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid |
| InChIKey | AOMOESAZLQVHAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=[N+]=[N-])O)C(=O)NCCSSCCC(=O)O |
Computed by PubChem (NCBI)