CAS 107427-86-1 is the registry number for ethyl 2-nitrilo-3-methylthio-3-(phenylamino)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg, 5000mg.
Ethyl (Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enoate (CAS 107427-86-1) is a chemical compound with the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. IUPAC name: ethyl (Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enoate. InChIKey: SXJJUZCQEIWUAO-QXMHVHEDSA-N.
| Molecular formula | C13H14N2O2S |
|---|---|
| Molecular weight | 262.33 g/mol |
| IUPAC name | ethyl (Z)-3-anilino-2-cyano-3-methylsulfanylprop-2-enoate |
| InChIKey | SXJJUZCQEIWUAO-QXMHVHEDSA-N |
| SMILES | CCOC(=O)/C(=C(/NC1=CC=CC=C1)\SC)/C#N |
Computed by PubChem (NCBI)