CAS 107475-10-5 appears in our catalog under these names: 4-Methylumbelliferyl phosphate di-(2-amino-2-methyl-1,3-propanediol)salt, 98%, 4-Methylumbelliferyl Phosphate Bis-(2-amino- 2-methyl-1,3-propanediol) Salt, >95% (HPLC), 4-Methylumbelliferyl phosphate, bis(2-amino-2-methyl-1,3-propanediol) salt, Substrate, 4-Methylumbelliferyl phosphate (2-amino-2-methyl-1,3-propanediol). Offered by: Combi-blocks, TRC, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g, 2g, 25g, 50g.
Bis(2-amino-2-methylpropane-1,3-diol);(4-methyl-2-oxochromen-7-yl) dihydrogen phosphate (CAS 107475-10-5) is a chemical compound with the molecular formula C18H31N2O10P and a molecular weight of 466.4 g/mol. IUPAC name: bis(2-amino-2-methylpropane-1,3-diol);(4-methyl-2-oxochromen-7-yl) dihydrogen phosphate. InChIKey: BFRZFPYLAVZIPA-UHFFFAOYSA-N.
| Molecular formula | C18H31N2O10P |
|---|---|
| Molecular weight | 466.4 g/mol |
| IUPAC name | bis(2-amino-2-methylpropane-1,3-diol);(4-methyl-2-oxochromen-7-yl) dihydrogen phosphate |
| InChIKey | BFRZFPYLAVZIPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OP(=O)(O)O.CC(CO)(CO)N.CC(CO)(CO)N |
Computed by PubChem (NCBI)