CAS 107484-69-5 appears in our catalog under these names: 5–Chloro–8–iodo–1,6–naphthyridine, 5-Chloro-8-iodo-1,6-naphthyridine, 5-Chloro-8-iodo-1,6-naphthyridine 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
5-chloro-8-iodo-1,6-naphthyridine (CAS 107484-69-5) is a chemical compound with the molecular formula C8H4ClIN2 and a molecular weight of 290.49 g/mol. IUPAC name: 5-chloro-8-iodo-1,6-naphthyridine. InChIKey: YSROTEYFZGPVRW-UHFFFAOYSA-N.
| Molecular formula | C8H4ClIN2 |
|---|---|
| Molecular weight | 290.49 g/mol |
| IUPAC name | 5-chloro-8-iodo-1,6-naphthyridine |
| InChIKey | YSROTEYFZGPVRW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2Cl)I)N=C1 |
Computed by PubChem (NCBI)