CAS 107535-73-9 appears in our catalog under these names: 2,3,5,6-Tetrafluorobenzoyl chloride, 95%, 2,3,5,6–Tetrafluorobenzoyl Chloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g.
2,3,5,6-tetrafluorobenzoyl chloride (CAS 107535-73-9) is a chemical compound with the molecular formula C7HClF4O and a molecular weight of 212.53 g/mol. IUPAC name: 2,3,5,6-tetrafluorobenzoyl chloride. InChIKey: AELMDUZWKHVPIF-UHFFFAOYSA-N.
| Molecular formula | C7HClF4O |
|---|---|
| Molecular weight | 212.53 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorobenzoyl chloride |
| InChIKey | AELMDUZWKHVPIF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C(=O)Cl)F)F |
Computed by PubChem (NCBI)