Products 107538-05-6
CAS 107538-05-6 is the registry number for Dexmecamylamine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S,4S)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine (CAS 107538-05-6) is a chemical compound with the molecular formula C11H21N and a molecular weight of 167.29 g/mol. IUPAC name: (1R,2S,4S)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine. InChIKey: IMYZQPCYWPFTAG-NGZCFLSTSA-N.
| Molecular formula | C11H21N |
|---|---|
| Molecular weight | 167.29 g/mol |
| IUPAC name | (1R,2S,4S)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine |
| InChIKey | IMYZQPCYWPFTAG-NGZCFLSTSA-N |
| SMILES | C[C@@]1([C@@H]2CC[C@@H](C2)C1(C)C)NC |
Computed by PubChem (NCBI)