CAS 107555-94-2 is the registry number for 1,2,3,6,7,8-Hexabromodibenzofuran. Offered by: TRC. Available pack sizes: 25mg.
1,2,3,6,7,8-hexabromodibenzofuran (CAS 107555-94-2) is a chemical compound with the molecular formula C12H2Br6O and a molecular weight of 641.6 g/mol. IUPAC name: 1,2,3,6,7,8-hexabromodibenzofuran. InChIKey: VUAFSJIMHSEWBL-UHFFFAOYSA-N.
| Molecular formula | C12H2Br6O |
|---|---|
| Molecular weight | 641.6 g/mol |
| IUPAC name | 1,2,3,6,7,8-hexabromodibenzofuran |
| InChIKey | VUAFSJIMHSEWBL-UHFFFAOYSA-N |
| SMILES | C1=C2C3=C(C(=C(C=C3OC2=C(C(=C1Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)