CAS 1075715-55-7 is the registry number for (S)-(4-Chlorophenyl)(cyclopropyl)methanamine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
(S)-(4-chlorophenyl)-cyclopropylmethanamine (CAS 1075715-55-7) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: (S)-(4-chlorophenyl)-cyclopropylmethanamine. InChIKey: VOLXFYJGXYAYQP-JTQLQIEISA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (S)-(4-chlorophenyl)-cyclopropylmethanamine |
| InChIKey | VOLXFYJGXYAYQP-JTQLQIEISA-N |
| SMILES | C1CC1[C@@H](C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)