CAS 1075734-32-5 is the registry number for tert-Butyl n-[(tert-butoxy)carbonyl]-n-(3-ethynylpyridin-2-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-(3-ethynyl-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1075734-32-5) is a chemical compound with the molecular formula C17H22N2O4 and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl N-(3-ethynyl-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: JDDBZBMRURPAAT-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl N-(3-ethynyl-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | JDDBZBMRURPAAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C=CC=N1)C#C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)