Products 107577-09-3

CAS 107577-09-3 is the registry number for 6-Chloropyrimidine-2,4-diol, 98%. Offered by: Combi-blocks. Available pack sizes: 100g, 5g, 500g, 1kg, 25g.

Structural formula: {0} (CAS {1})

6-chloro-1H-pyrimidine-2,4-dione (CAS 107577-09-3) is a chemical compound with the molecular formula C4H3ClN2O2 and a molecular weight of 146.53 g/mol. IUPAC name: 6-chloro-1H-pyrimidine-2,4-dione. InChIKey: PKUFNWPSFCOSLU-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3ClN2O2
Molecular weight146.53 g/mol
IUPAC name6-chloro-1H-pyrimidine-2,4-dione
InChIKeyPKUFNWPSFCOSLU-UHFFFAOYSA-N
SMILESC1=C(NC(=O)NC1=O)Cl

Computed by PubChem (NCBI)