CAS 107583-37-9 appears in our catalog under these names: 5,6,7–Trifluoroindoline–2,3–dione, 5,6,7-Trifluoroindoline-2,3-dione 95%, 5,6,7-Trifluoroindoline-2,3-dione, 95%, 95%, 5,6,7-Trifluoroindoline-2,3-dione, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
5,6,7-trifluoro-1H-indole-2,3-dione (CAS 107583-37-9) is a chemical compound with the molecular formula C8H2F3NO2 and a molecular weight of 201.10 g/mol. IUPAC name: 5,6,7-trifluoro-1H-indole-2,3-dione. InChIKey: PEUYIHPRMAETGU-UHFFFAOYSA-N.
| Molecular formula | C8H2F3NO2 |
|---|---|
| Molecular weight | 201.10 g/mol |
| IUPAC name | 5,6,7-trifluoro-1H-indole-2,3-dione |
| InChIKey | PEUYIHPRMAETGU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1F)F)F)NC(=O)C2=O |
Computed by PubChem (NCBI)