CAS 107595-49-3 appears in our catalog under these names: Clofentezine-3-hydroxy, Clofentezine Metabolite 1, Clofentezine Impurity 2, Clofentezine-3-hydroxy, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards, Chemat Brand, Hubei YoungXin. Available pack sizes: 1x10mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1x1ml.
2-chloro-3-[6-(2-chlorophenyl)-1,2,4,5-tetrazin-3-yl]phenol (CAS 107595-49-3) is a chemical compound with the molecular formula C14H8Cl2N4O and a molecular weight of 319.1 g/mol. IUPAC name: 2-chloro-3-[6-(2-chlorophenyl)-1,2,4,5-tetrazin-3-yl]phenol. InChIKey: YNKXOHAAMDSSSI-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N4O |
|---|---|
| Molecular weight | 319.1 g/mol |
| IUPAC name | 2-chloro-3-[6-(2-chlorophenyl)-1,2,4,5-tetrazin-3-yl]phenol |
| InChIKey | YNKXOHAAMDSSSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(N=N2)C3=C(C(=CC=C3)O)Cl)Cl |
Computed by PubChem (NCBI)