CAS 107596-31-6 appears in our catalog under these names: (1S,2R,4R)-N,2,3,3-Tetramethylbicyclo[2.2.1]heptan-2-amine hydrochloride, 98%, R-(-)-Mecamylamine Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
(1S,2R,4R)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 107596-31-6) is a chemical compound with the molecular formula C11H22ClN and a molecular weight of 203.75 g/mol. IUPAC name: (1S,2R,4R)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: PKVZBNCYEICAQP-GITWGATASA-N.
| Molecular formula | C11H22ClN |
|---|---|
| Molecular weight | 203.75 g/mol |
| IUPAC name | (1S,2R,4R)-N,2,3,3-tetramethylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | PKVZBNCYEICAQP-GITWGATASA-N |
| SMILES | C[C@]1([C@H]2CC[C@H](C2)C1(C)C)NC.Cl |
Computed by PubChem (NCBI)