CAS 1076-37-5 is the registry number for 3-Chloro-1-fluoroisoquinoline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-chloro-1-fluoroisoquinoline (CAS 1076-37-5) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 3-chloro-1-fluoroisoquinoline. InChIKey: OOXCVIHHHNGMBQ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 3-chloro-1-fluoroisoquinoline |
| InChIKey | OOXCVIHHHNGMBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=C2F)Cl |
Computed by PubChem (NCBI)