CAS 1076160-64-9 is the registry number for (R,E)-N-(1-(3-Bromophenyl)ethylidene)-2-methylpropane-2-sulfinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(R)-N-[1-(3-bromophenyl)ethylidene]-2-methylpropane-2-sulfinamide (CAS 1076160-64-9) is a chemical compound with the molecular formula C12H16BrNOS and a molecular weight of 302.23 g/mol. IUPAC name: (R)-N-[1-(3-bromophenyl)ethylidene]-2-methylpropane-2-sulfinamide. InChIKey: LJYVHAAXTPZBPB-MRXNPFEDSA-N.
| Molecular formula | C12H16BrNOS |
|---|---|
| Molecular weight | 302.23 g/mol |
| IUPAC name | (R)-N-[1-(3-bromophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| InChIKey | LJYVHAAXTPZBPB-MRXNPFEDSA-N |
| SMILES | CC(=N[S@](=O)C(C)(C)C)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)