Products 1076197-30-2
CAS 1076197-30-2 is the registry number for (Piperidin-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 5000mg, 250mg, 500mg, 1000mg.
(5-amino-1-phenylpyrazol-3-yl)-piperidin-1-ylmethanone (CAS 1076197-30-2) is a chemical compound with the molecular formula C15H18N4O and a molecular weight of 270.33 g/mol. IUPAC name: (5-amino-1-phenylpyrazol-3-yl)-piperidin-1-ylmethanone. InChIKey: QHJGAQCMEUGHEG-UHFFFAOYSA-N.
| Molecular formula | C15H18N4O |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | (5-amino-1-phenylpyrazol-3-yl)-piperidin-1-ylmethanone |
| InChIKey | QHJGAQCMEUGHEG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=NN(C(=C2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)