Products 1076198-04-3

CAS 1076198-04-3 is the registry number for Ethyl (2-Diethylaminothiocarboxyl))phenylacetate. Offered by: TRC. Available pack sizes: 100mg, 1g, 2g.

Structural formula: {0} (CAS {1})

Ethyl 2-[2-(diethylcarbamothioyloxy)phenyl]acetate (CAS 1076198-04-3) is a chemical compound with the molecular formula C15H21NO3S and a molecular weight of 295.4 g/mol. IUPAC name: ethyl 2-[2-(diethylcarbamothioyloxy)phenyl]acetate. InChIKey: CWPJDOYYUFVONE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21NO3S
Molecular weight295.4 g/mol
IUPAC nameethyl 2-[2-(diethylcarbamothioyloxy)phenyl]acetate
InChIKeyCWPJDOYYUFVONE-UHFFFAOYSA-N
SMILESCCN(CC)C(=S)OC1=CC=CC=C1CC(=O)OCC

Computed by PubChem (NCBI)