Products 1076198-13-4
CAS 1076198-13-4 is the registry number for Bupropion Impurity 29. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-(4-fluorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]propan-1-one (CAS 1076198-13-4) is a chemical compound with the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]propan-1-one. InChIKey: LXAJJRTTWLABBD-UHFFFAOYSA-N.
| Molecular formula | C13H18FNO2 |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]propan-1-one |
| InChIKey | LXAJJRTTWLABBD-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)F)NC(C)(C)CO |
Computed by PubChem (NCBI)