CAS 1076198-64-5 appears in our catalog under these names: Mycophenolate Mofetil (Mixture of E and Z Isomers), Mycophenolate mofetil Impurity 32, Mycophenolate Mofetil Impurity 3（Mycophenolate Mofetil EP Impurity C）, Mycophenolate Mofetil (E/Z mixture), >95% (HPLC), Mycophenolate mofetil. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
2-morpholin-4-ylethyl 6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (CAS 1076198-64-5) is a chemical compound with the molecular formula C23H31NO7 and a molecular weight of 433.5 g/mol. IUPAC name: 2-morpholin-4-ylethyl 6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate. InChIKey: RTGDFNSFWBGLEC-UHFFFAOYSA-N.
| Molecular formula | C23H31NO7 |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 2-morpholin-4-ylethyl 6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChIKey | RTGDFNSFWBGLEC-UHFFFAOYSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)CC=C(C)CCC(=O)OCCN3CCOCC3)O |
Computed by PubChem (NCBI)