Products 1076198-71-4

CAS 1076198-71-4 is the registry number for Anagrelide 5-Acetoxy Impurity. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(6,7-dichloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-5-yl) acetate (CAS 1076198-71-4) is a chemical compound with the molecular formula C12H9Cl2N3O3 and a molecular weight of 314.12 g/mol. IUPAC name: (6,7-dichloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-5-yl) acetate. InChIKey: YKCRALKUPKUNKC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9Cl2N3O3
Molecular weight314.12 g/mol
IUPAC name(6,7-dichloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-5-yl) acetate
InChIKeyYKCRALKUPKUNKC-UHFFFAOYSA-N
SMILESCC(=O)OC1C2=C(C=CC(=C2Cl)Cl)N=C3N1CC(=O)N3

Computed by PubChem (NCBI)